Products 1403564-65-7
CAS 1403564-65-7 appears in our catalog under these names: 7'-Chlorospiro[cyclopropane-1,3'-indolin]-2'-one, 95%, 7'-Chlorospiro[cyclopropane-1,3'-indolin]-2'-one, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 1403564-65-7) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 7-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: FRCZUQVFAWMDIC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 7-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | FRCZUQVFAWMDIC-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C(=CC=C3)Cl)NC2=O |
Computed by PubChem (NCBI)