CAS 1403579-58-7 appears in our catalog under these names: 6-Bromo-7-methyl-1H-indole-3-carbaldehyde, 95%, 6-Bromo-7-methyl-1H-indole-3-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-bromo-7-methyl-1H-indole-3-carbaldehyde (CAS 1403579-58-7) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 6-bromo-7-methyl-1H-indole-3-carbaldehyde. InChIKey: KLIIKDOYUDQXDR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 6-bromo-7-methyl-1H-indole-3-carbaldehyde |
| InChIKey | KLIIKDOYUDQXDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC=C2C=O)Br |
Computed by PubChem (NCBI)