CAS 1403667-43-5 is the registry number for Sodium 2,2–difluorohexanoate. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Sodium 2,2-difluorohexanoate (CAS 1403667-43-5) is a chemical compound with the molecular formula C6H9F2NaO2 and a molecular weight of 174.12 g/mol. IUPAC name: sodium 2,2-difluorohexanoate. InChIKey: WZVLOZXYHMQMIH-UHFFFAOYSA-M.
| Molecular formula | C6H9F2NaO2 |
|---|---|
| Molecular weight | 174.12 g/mol |
| IUPAC name | sodium 2,2-difluorohexanoate |
| InChIKey | WZVLOZXYHMQMIH-UHFFFAOYSA-M |
| SMILES | CCCCC(C(=O)[O-])(F)F.[Na+] |
Computed by PubChem (NCBI)