Products 1403679-33-3
CAS 1403679-33-3 is the registry number for NMS-P953. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(2-aminopyrimidin-4-yl)-2-[2-chloro-5-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide (CAS 1403679-33-3) is a chemical compound with the molecular formula C16H11ClF3N5O and a molecular weight of 381.74 g/mol. IUPAC name: 5-(2-aminopyrimidin-4-yl)-2-[2-chloro-5-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide. InChIKey: CZUQYAXYBOEHCY-UHFFFAOYSA-N.
| Molecular formula | C16H11ClF3N5O |
|---|---|
| Molecular weight | 381.74 g/mol |
| IUPAC name | 5-(2-aminopyrimidin-4-yl)-2-[2-chloro-5-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
| InChIKey | CZUQYAXYBOEHCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C2=C(C=C(N2)C3=NC(=NC=C3)N)C(=O)N)Cl |
Computed by PubChem (NCBI)
Synonyms:
4d0x, orb1738726