CAS 1403901-84-7 is the registry number for tert-Butyl (2R,5R)-5-(difluoromethyl)-2-methylpiperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,5R)-5-(difluoromethyl)-2-methylpiperazine-1-carboxylate (CAS 1403901-84-7) is a chemical compound with the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. IUPAC name: tert-butyl (2R,5R)-5-(difluoromethyl)-2-methylpiperazine-1-carboxylate. InChIKey: BZMIPCTYIUBXKY-HTQZYQBOSA-N.
| Molecular formula | C11H20F2N2O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | tert-butyl (2R,5R)-5-(difluoromethyl)-2-methylpiperazine-1-carboxylate |
| InChIKey | BZMIPCTYIUBXKY-HTQZYQBOSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C(=O)OC(C)(C)C)C(F)F |
Computed by PubChem (NCBI)