Products 1403933-79-8
CAS 1403933-79-8 is the registry number for PP2A Cancerous-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-N-(3-ethynylphenyl)-6,7-dimethoxy-2-N-(4-phenoxyphenyl)quinazoline-2,4-diamine (CAS 1403933-79-8) is a chemical compound with the molecular formula C30H24N4O3 and a molecular weight of 488.5 g/mol. IUPAC name: 4-N-(3-ethynylphenyl)-6,7-dimethoxy-2-N-(4-phenoxyphenyl)quinazoline-2,4-diamine. InChIKey: UESUTKPLJQKPRL-UHFFFAOYSA-N.
| Molecular formula | C30H24N4O3 |
|---|---|
| Molecular weight | 488.5 g/mol |
| IUPAC name | 4-N-(3-ethynylphenyl)-6,7-dimethoxy-2-N-(4-phenoxyphenyl)quinazoline-2,4-diamine |
| InChIKey | UESUTKPLJQKPRL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)NC3=CC=C(C=C3)OC4=CC=CC=C4)NC5=CC=CC(=C5)C#C)OC |
Computed by PubChem (NCBI)