CAS 1403940-81-7 is the registry number for Hydroxydihydrobovolide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5S)-5-hydroxy-3,4-dimethyl-5-pentylfuran-2-one (CAS 1403940-81-7) is a chemical compound with the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. IUPAC name: (5S)-5-hydroxy-3,4-dimethyl-5-pentylfuran-2-one. InChIKey: VJZWZDQDXPADSE-NSHDSACASA-N.
| Molecular formula | C11H18O3 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | (5S)-5-hydroxy-3,4-dimethyl-5-pentylfuran-2-one |
| InChIKey | VJZWZDQDXPADSE-NSHDSACASA-N |
| SMILES | CCCCC[C@]1(C(=C(C(=O)O1)C)C)O |
Computed by PubChem (NCBI)