CAS 140401-56-5 appears in our catalog under these names: 1-(3,5-Di-tert-butylphenyl)methanamine hydrochloride, (3,5-DI-TERT-BUTYLPHENYL)METHANAMINE HYDROCHLORIDE, 97%, 97%, 1-(3,5-di-tert-butylphenyl)methanamine hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 500mg.
(3,5-ditert-butylphenyl)methanamine;hydrochloride (CAS 140401-56-5) is a chemical compound with the molecular formula C15H26ClN and a molecular weight of 255.82 g/mol. IUPAC name: (3,5-ditert-butylphenyl)methanamine;hydrochloride. InChIKey: MYOBEFPUMUXWHO-UHFFFAOYSA-N.
| Molecular formula | C15H26ClN |
|---|---|
| Molecular weight | 255.82 g/mol |
| IUPAC name | (3,5-ditert-butylphenyl)methanamine;hydrochloride |
| InChIKey | MYOBEFPUMUXWHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)CN)C(C)(C)C.Cl |
Computed by PubChem (NCBI)