CAS 1404091-23-1 appears in our catalog under these names: NucPE1 (Nuclear Peroxy Emerald 1), NucPE1, 98%, NucPE1, NucPE1 98%, NucPE1, 98%, 98%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 10mg, 100mg, 5mg, 50mg, 25mg, 10 mg, 50 mg.
3'-(ethylamino)-2'-methyl-6'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 1404091-23-1) is a chemical compound with the molecular formula C29H30BNO5 and a molecular weight of 483.4 g/mol. IUPAC name: 3'-(ethylamino)-2'-methyl-6'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: GHPDUBPWQBBRPG-UHFFFAOYSA-N.
| Molecular formula | C29H30BNO5 |
|---|---|
| Molecular weight | 483.4 g/mol |
| IUPAC name | 3'-(ethylamino)-2'-methyl-6'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | GHPDUBPWQBBRPG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4(C5=CC=CC=C5C(=O)O4)C6=C(O3)C=C(C(=C6)C)NCC |
Computed by PubChem (NCBI)