CAS 140411-20-7 is the registry number for 4-Iodo-2,6-diisopropylaniline 98%. Offered by: Ambeed. Available pack sizes: 1g, 100mg, 250mg.
4-iodo-2,6-di(propan-2-yl)aniline (CAS 140411-20-7) is a chemical compound with the molecular formula C12H18IN and a molecular weight of 303.18 g/mol. IUPAC name: 4-iodo-2,6-di(propan-2-yl)aniline. InChIKey: VSUZUVYNMYZNMN-UHFFFAOYSA-N.
| Molecular formula | C12H18IN |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | 4-iodo-2,6-di(propan-2-yl)aniline |
| InChIKey | VSUZUVYNMYZNMN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)I |
Computed by PubChem (NCBI)