CAS 1404196-20-8 appears in our catalog under these names: 4-(Benzyl(methyl)amino)-3,5-difluorobenzoic acid, 95%, 4–(Benzyl(methyl)amino)–3，5–difluorobenzoic acid, 4-(benzyl(methyl)amino)-3,5-difluorobenzoic acid. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4-[benzyl(methyl)amino]-3,5-difluorobenzoic acid (CAS 1404196-20-8) is a chemical compound with the molecular formula C15H13F2NO2 and a molecular weight of 277.27 g/mol. IUPAC name: 4-[benzyl(methyl)amino]-3,5-difluorobenzoic acid. InChIKey: MMNHHHWZKYKLCL-UHFFFAOYSA-N.
| Molecular formula | C15H13F2NO2 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | 4-[benzyl(methyl)amino]-3,5-difluorobenzoic acid |
| InChIKey | MMNHHHWZKYKLCL-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C2=C(C=C(C=C2F)C(=O)O)F |
Computed by PubChem (NCBI)