Products 1404196-69-5

CAS 1404196-69-5 is the registry number for tert-Butyl tert-butyl 2,9-diazaspiro[5.5]undecane-2,9-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Ditert-butyl 2,9-diazaspiro[5.5]undecane-2,9-dicarboxylate (CAS 1404196-69-5) is a chemical compound with the molecular formula C19H34N2O4 and a molecular weight of 354.5 g/mol. IUPAC name: ditert-butyl 2,9-diazaspiro[5.5]undecane-2,9-dicarboxylate. InChIKey: BRLZCJUOAHCFRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H34N2O4
Molecular weight354.5 g/mol
IUPAC nameditert-butyl 2,9-diazaspiro[5.5]undecane-2,9-dicarboxylate
InChIKeyBRLZCJUOAHCFRJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCCN(C2)C(=O)OC(C)(C)C)CC1

Computed by PubChem (NCBI)