Products 1404289-52-6
CAS 1404289-52-6 is the registry number for TXA497. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[3-(4-tert-butylphenyl)phenyl]methyl]guanidine (CAS 1404289-52-6) is a chemical compound with the molecular formula C18H23N3 and a molecular weight of 281.4 g/mol. IUPAC name: 2-[[3-(4-tert-butylphenyl)phenyl]methyl]guanidine. InChIKey: IJMFAQGRFMHTGK-UHFFFAOYSA-N.
| Molecular formula | C18H23N3 |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 2-[[3-(4-tert-butylphenyl)phenyl]methyl]guanidine |
| InChIKey | IJMFAQGRFMHTGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=CC(=C2)CN=C(N)N |
Computed by PubChem (NCBI)