CAS 140430-54-2 appears in our catalog under these names: Fmoc–Dap(Dnp)–OH, Fmoc-L-Dap(Dnp)-OH, Fmoc-Dap(DNP)-OH 98%, 3-[(2,4-Dinitrophenyl)amino]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanine, 98%, 98%, N-beta-2,4-Dinitrophenyl Fmoc-l-diaminopropionic acid, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 100mg, 250mg, 10g.
(2S)-3-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 140430-54-2) is a chemical compound with the molecular formula C24H20N4O8 and a molecular weight of 492.4 g/mol. IUPAC name: (2S)-3-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: GLJCJFFDYXFRQX-NRFANRHFSA-N.
| Molecular formula | C24H20N4O8 |
|---|---|
| Molecular weight | 492.4 g/mol |
| IUPAC name | (2S)-3-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | GLJCJFFDYXFRQX-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CNC4=C(C=C(C=C4)[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)