CAS 1404308-02-6 appears in our catalog under these names: (1-Oxyl-2,2,5,5-tetramethyl-∆3-pyrroline-3-methyl) Methanethiosulfonate-15N, (1-Oxyl-2,2,5,5-tetramethyl-Delta3-pyrroline-3-methyl) Methanethiosulfonate-15N, MTSSL-15N. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 50 mg, 1 mg, 10 mg.
CAS 1404308-02-6 identifies a chemical compound with the molecular formula C10H18NO3S2 and a molecular weight of 265.4 g/mol. InChIKey: BLSCGBLQCTWVPO-KHWBWMQUSA-N.
| Molecular formula | C10H18NO3S2 |
|---|---|
| Molecular weight | 265.4 g/mol |
| InChIKey | BLSCGBLQCTWVPO-KHWBWMQUSA-N |
| SMILES | CC1(C=C(C([15N]1[O])(C)C)CSS(=O)(=O)C)C |
Computed by PubChem (NCBI)