CAS 1404431-71-5 is the registry number for (5-Bromopyridin-2-yl)methyl 4-nitrophenyl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(5-bromo-2-pyridinyl)methyl (4-nitrophenyl) carbonate (CAS 1404431-71-5) is a chemical compound with the molecular formula C13H9BrN2O5 and a molecular weight of 353.12 g/mol. IUPAC name: (5-bromo-2-pyridinyl)methyl (4-nitrophenyl) carbonate. InChIKey: VAAGFCZFOJAIOM-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O5 |
|---|---|
| Molecular weight | 353.12 g/mol |
| IUPAC name | (5-bromo-2-pyridinyl)methyl (4-nitrophenyl) carbonate |
| InChIKey | VAAGFCZFOJAIOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OCC2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)