CAS 1404436-51-6 appears in our catalog under these names: LYP–IN–1, LYP-IN-1, 99.78%, 99.78%, LYP-IN-1, 99.82%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 50 mg, 10 mg, 5 mg, 25 mg, 100 mg.
3-[2-(3-chlorophenyl)ethynyl]-2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]-6-hydroxy-1-benzofuran-5-carboxylic acid (CAS 1404436-51-6) is a chemical compound with the molecular formula C28H20ClNO6 and a molecular weight of 501.9 g/mol. IUPAC name: 3-[2-(3-chlorophenyl)ethynyl]-2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]-6-hydroxy-1-benzofuran-5-carboxylic acid. InChIKey: IIURSEJMCKFEQG-UHFFFAOYSA-N.
| Molecular formula | C28H20ClNO6 |
|---|---|
| Molecular weight | 501.9 g/mol |
| IUPAC name | 3-[2-(3-chlorophenyl)ethynyl]-2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]-6-hydroxy-1-benzofuran-5-carboxylic acid |
| InChIKey | IIURSEJMCKFEQG-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)COC2=CC=C(C=C2)C3=C(C4=CC(=C(C=C4O3)O)C(=O)O)C#CC5=CC(=CC=C5)Cl |
Computed by PubChem (NCBI)