CAS 1404457-08-4 appears in our catalog under these names: (S)-2-amino-3-cyclopentyl-N-cyclopropylpropanamide hydrochloride, 96%, (2S)-2-amino-3-cyclopentyl-N-cyclopropylpropanamide hydrochloride, 95%, 95%, (S)-2-amino-3-cyclopentyl-N-cyclopropylpropanamide hydrochloride, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-amino-3-cyclopentyl-N-cyclopropylpropanamide;hydrochloride (CAS 1404457-08-4) is a chemical compound with the molecular formula C11H21ClN2O and a molecular weight of 232.75 g/mol. IUPAC name: (2S)-2-amino-3-cyclopentyl-N-cyclopropylpropanamide;hydrochloride. InChIKey: SNFQEDIEMIWJNK-PPHPATTJSA-N.
| Molecular formula | C11H21ClN2O |
|---|---|
| Molecular weight | 232.75 g/mol |
| IUPAC name | (2S)-2-amino-3-cyclopentyl-N-cyclopropylpropanamide;hydrochloride |
| InChIKey | SNFQEDIEMIWJNK-PPHPATTJSA-N |
| SMILES | C1CCC(C1)C[C@@H](C(=O)NC2CC2)N.Cl |
Computed by PubChem (NCBI)