CAS 1404477-10-6 appears in our catalog under these names: (5-Bromo-2-chlorophenyl)(2-ethoxyphenyl)methanone, 95%, Dapagliflozin Impurity 2, Dapagliflozin Impurity 68, 5-Bromo-2-chloro-2’-ethoxy Benzophenone. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(5-bromo-2-chlorophenyl)-(2-ethoxyphenyl)methanone (CAS 1404477-10-6) is a chemical compound with the molecular formula C15H12BrClO2 and a molecular weight of 339.61 g/mol. IUPAC name: (5-bromo-2-chlorophenyl)-(2-ethoxyphenyl)methanone. InChIKey: HBYJBBCGIIGJKX-UHFFFAOYSA-N.
| Molecular formula | C15H12BrClO2 |
|---|---|
| Molecular weight | 339.61 g/mol |
| IUPAC name | (5-bromo-2-chlorophenyl)-(2-ethoxyphenyl)methanone |
| InChIKey | HBYJBBCGIIGJKX-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1C(=O)C2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)