CAS 1404491-67-3 is the registry number for 2–(3,5–Dimethylphenyl)–5–isobutylquinoline. Offered by: GLPBio. Available pack sizes: 1g.
2-(3,5-dimethylphenyl)-5-(2-methylpropyl)quinoline (CAS 1404491-67-3) is a chemical compound with the molecular formula C21H23N and a molecular weight of 289.4 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-5-(2-methylpropyl)quinoline. InChIKey: YGPAVZADFDNQFB-UHFFFAOYSA-N.
| Molecular formula | C21H23N |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-5-(2-methylpropyl)quinoline |
| InChIKey | YGPAVZADFDNQFB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=NC3=CC=CC(=C3C=C2)CC(C)C)C |
Computed by PubChem (NCBI)