CAS 1404506-35-9 appears in our catalog under these names: BF 544, BF844. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 50mg, 2mg, 10mg, 5mg, 25mg, Get quote.
1-(4-chloro-3,5-diphenylpyrazolo[3,4-c]pyridazin-1-yl)-2-methylpropan-2-ol (CAS 1404506-35-9) is a chemical compound with the molecular formula C21H19ClN4O and a molecular weight of 378.9 g/mol. IUPAC name: 1-(4-chloro-3,5-diphenylpyrazolo[3,4-c]pyridazin-1-yl)-2-methylpropan-2-ol. InChIKey: TVNSCKMVODVWRS-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN4O |
|---|---|
| Molecular weight | 378.9 g/mol |
| IUPAC name | 1-(4-chloro-3,5-diphenylpyrazolo[3,4-c]pyridazin-1-yl)-2-methylpropan-2-ol |
| InChIKey | TVNSCKMVODVWRS-UHFFFAOYSA-N |
| SMILES | CC(C)(CN1C2=NN=C(C(=C2C(=N1)C3=CC=CC=C3)Cl)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)