CAS 14046-52-7 appears in our catalog under these names: Lifitegrast Impurity 41 HCl, Lifitegrast Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-[(3,5-dichlorophenyl)methyl]ethanamine;hydrochloride (CAS 14046-52-7) is a chemical compound with the molecular formula C9H11Cl4N and a molecular weight of 275.0 g/mol. IUPAC name: 2-chloro-N-[(3,5-dichlorophenyl)methyl]ethanamine;hydrochloride. InChIKey: WGYRHIDDVNCWPA-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl4N |
|---|---|
| Molecular weight | 275.0 g/mol |
| IUPAC name | 2-chloro-N-[(3,5-dichlorophenyl)methyl]ethanamine;hydrochloride |
| InChIKey | WGYRHIDDVNCWPA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)CNCCCl.Cl |
Computed by PubChem (NCBI)