Products 1405585-02-5

CAS 1405585-02-5 is the registry number for 8-Bromo-2-(3-fluorophenyl)quinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

8-bromo-2-(3-fluorophenyl)quinoline-4-carboxylic acid (CAS 1405585-02-5) is a chemical compound with the molecular formula C16H9BrFNO2 and a molecular weight of 346.15 g/mol. IUPAC name: 8-bromo-2-(3-fluorophenyl)quinoline-4-carboxylic acid. InChIKey: ILIFDXNBTKGHGN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9BrFNO2
Molecular weight346.15 g/mol
IUPAC name8-bromo-2-(3-fluorophenyl)quinoline-4-carboxylic acid
InChIKeyILIFDXNBTKGHGN-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)C2=NC3=C(C=CC=C3Br)C(=C2)C(=O)O

Computed by PubChem (NCBI)