CAS 1405844-43-0 is the registry number for 5-Bromo-N-(3-chloro-4-methylphenyl)pyridine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-bromo-N-(3-chloro-4-methylphenyl)pyridine-2-carboxamide (CAS 1405844-43-0) is a chemical compound with the molecular formula C13H10BrClN2O and a molecular weight of 325.59 g/mol. IUPAC name: 5-bromo-N-(3-chloro-4-methylphenyl)pyridine-2-carboxamide. InChIKey: UNDYRGMQUUKKQY-UHFFFAOYSA-N.
| Molecular formula | C13H10BrClN2O |
|---|---|
| Molecular weight | 325.59 g/mol |
| IUPAC name | 5-bromo-N-(3-chloro-4-methylphenyl)pyridine-2-carboxamide |
| InChIKey | UNDYRGMQUUKKQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=NC=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)