CAS 14062-80-7 appears in our catalog under these names: 4–Chloro–N,N–dimethylbenzamide, 4-Chloro-N,N-dimethylbenzamide 98%, 4-Chloro-N,N-dimethylbenzamide, 98%, 98%, 4-Chloro-N,N-dimethylbenzamide, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 100mg, 250mg.
4-chloro-N,N-dimethylbenzamide (CAS 14062-80-7) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 4-chloro-N,N-dimethylbenzamide. InChIKey: FARSXMMESQDZMY-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 4-chloro-N,N-dimethylbenzamide |
| InChIKey | FARSXMMESQDZMY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)