Products 140646-80-6
CAS 140646-80-6 is the registry number for MCI826. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg, 5 mg, 5mg.
2,2-diethyl-4-oxo-4-[3-[(E)-2-(4-propan-2-yl-1,3-thiazol-2-yl)ethenyl]anilino]butanoic acid (CAS 140646-80-6) is a chemical compound with the molecular formula C22H28N2O3S and a molecular weight of 400.5 g/mol. IUPAC name: 2,2-diethyl-4-oxo-4-[3-[(E)-2-(4-propan-2-yl-1,3-thiazol-2-yl)ethenyl]anilino]butanoic acid. InChIKey: PGLNVMJTDKEOBE-ZHACJKMWSA-N.
| Molecular formula | C22H28N2O3S |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 2,2-diethyl-4-oxo-4-[3-[(E)-2-(4-propan-2-yl-1,3-thiazol-2-yl)ethenyl]anilino]butanoic acid |
| InChIKey | PGLNVMJTDKEOBE-ZHACJKMWSA-N |
| SMILES | CCC(CC)(CC(=O)NC1=CC=CC(=C1)/C=C/C2=NC(=CS2)C(C)C)C(=O)O |
Computed by PubChem (NCBI)