CAS 1406477-36-8 appears in our catalog under these names: 3-Chloro-4-(2,3-dichlorophenoxy)benzoic acid, 95%, 3-Chloro-4-(2,3-dichlorophenoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-chloro-4-(2,3-dichlorophenoxy)benzoic acid (CAS 1406477-36-8) is a chemical compound with the molecular formula C13H7Cl3O3 and a molecular weight of 317.5 g/mol. IUPAC name: 3-chloro-4-(2,3-dichlorophenoxy)benzoic acid. InChIKey: NAFBPXSORBZBRV-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl3O3 |
|---|---|
| Molecular weight | 317.5 g/mol |
| IUPAC name | 3-chloro-4-(2,3-dichlorophenoxy)benzoic acid |
| InChIKey | NAFBPXSORBZBRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OC2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)