CAS 1407158-19-3 is the registry number for (2-(9H-Carbazol-9-yl)dibenzo[b,d]furan-4,6-diyl)bis(diphenylphosphine oxide), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-[4,6-bis(diphenylphosphoryl)dibenzofuran-2-yl]carbazole (CAS 1407158-19-3) is a chemical compound with the molecular formula C48H33NO3P2 and a molecular weight of 733.7 g/mol. IUPAC name: 9-[4,6-bis(diphenylphosphoryl)dibenzofuran-2-yl]carbazole. InChIKey: BHHSGVMOSLIEGA-UHFFFAOYSA-N.
| Molecular formula | C48H33NO3P2 |
|---|---|
| Molecular weight | 733.7 g/mol |
| IUPAC name | 9-[4,6-bis(diphenylphosphoryl)dibenzofuran-2-yl]carbazole |
| InChIKey | BHHSGVMOSLIEGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC4=C3OC5=C4C=C(C=C5P(=O)(C6=CC=CC=C6)C7=CC=CC=C7)N8C9=CC=CC=C9C1=CC=CC=C18 |
Computed by PubChem (NCBI)