CAS 1407521-73-6 is the registry number for 4-Chloro-2-(methyl-d3)phenol. Offered by: TRC. Available pack sizes: 25mg.
4-chloro-2-(trideuteriomethyl)phenol (CAS 1407521-73-6) is a chemical compound with the molecular formula C7H7ClO and a molecular weight of 145.60 g/mol. IUPAC name: 4-chloro-2-(trideuteriomethyl)phenol. InChIKey: RHPUJHQBPORFGV-FIBGUPNXSA-N.
| Molecular formula | C7H7ClO |
|---|---|
| Molecular weight | 145.60 g/mol |
| IUPAC name | 4-chloro-2-(trideuteriomethyl)phenol |
| InChIKey | RHPUJHQBPORFGV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC(=C1)Cl)O |
Computed by PubChem (NCBI)