Products 1408002-81-2
CAS 1408002-81-2 is the registry number for (S)-1-Boc-pyrrolidine-3-carboxylic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl (3S)-3-(hydrazinecarbonyl)pyrrolidine-1-carboxylate (CAS 1408002-81-2) is a chemical compound with the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. IUPAC name: tert-butyl (3S)-3-(hydrazinecarbonyl)pyrrolidine-1-carboxylate. InChIKey: HFMHEXPZANOFSL-ZETCQYMHSA-N.
| Molecular formula | C10H19N3O3 |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | tert-butyl (3S)-3-(hydrazinecarbonyl)pyrrolidine-1-carboxylate |
| InChIKey | HFMHEXPZANOFSL-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)C(=O)NN |
Computed by PubChem (NCBI)