CAS 1408075-61-5 is the registry number for tert-Butyl (3aR,5S,7aS)-rel-5-aminooctahydro-2H-isoindole-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl (3aR,5S,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (CAS 1408075-61-5) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl (3aR,5S,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate. InChIKey: LLTJKZQPTQJCDC-VWYCJHECSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl (3aR,5S,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| InChIKey | LLTJKZQPTQJCDC-VWYCJHECSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H](C[C@H]2C1)N |
Computed by PubChem (NCBI)