Products 1408076-33-4

CAS 1408076-33-4 is the registry number for 3-Amino-1-boc-3-methylpiperidine hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Bis(tert-butyl 3-amino-3-methylpiperidine-1-carboxylate);oxalic acid (CAS 1408076-33-4) is a chemical compound with the molecular formula C24H46N4O8 and a molecular weight of 518.6 g/mol. IUPAC name: bis(tert-butyl 3-amino-3-methylpiperidine-1-carboxylate);oxalic acid. InChIKey: QDCPRKDOABNMRU-UHFFFAOYSA-N.

Identity
Molecular formulaC24H46N4O8
Molecular weight518.6 g/mol
IUPAC namebis(tert-butyl 3-amino-3-methylpiperidine-1-carboxylate);oxalic acid
InChIKeyQDCPRKDOABNMRU-UHFFFAOYSA-N
SMILESCC1(CCCN(C1)C(=O)OC(C)(C)C)N.CC1(CCCN(C1)C(=O)OC(C)(C)C)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)