CAS 1408076-33-4 is the registry number for 3-Amino-1-boc-3-methylpiperidine hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Bis(tert-butyl 3-amino-3-methylpiperidine-1-carboxylate);oxalic acid (CAS 1408076-33-4) is a chemical compound with the molecular formula C24H46N4O8 and a molecular weight of 518.6 g/mol. IUPAC name: bis(tert-butyl 3-amino-3-methylpiperidine-1-carboxylate);oxalic acid. InChIKey: QDCPRKDOABNMRU-UHFFFAOYSA-N.
| Molecular formula | C24H46N4O8 |
|---|---|
| Molecular weight | 518.6 g/mol |
| IUPAC name | bis(tert-butyl 3-amino-3-methylpiperidine-1-carboxylate);oxalic acid |
| InChIKey | QDCPRKDOABNMRU-UHFFFAOYSA-N |
| SMILES | CC1(CCCN(C1)C(=O)OC(C)(C)C)N.CC1(CCCN(C1)C(=O)OC(C)(C)C)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)