CAS 1408238-36-7 appears in our catalog under these names: Dabigatran Impurity 75, Dabigatran Impurity 9, Dabigatran Etexilate Impurity 12, Dabigatran Impurity H, Des-(N-2-pyridyl-Beta-alanine Ethyl Ester) Dabigatran Etexilate 5-Ethyl Carboxylate (Dabigatran Impurity), >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress, Fluorochem. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 25 mg.
Ethyl 2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carboxylate (CAS 1408238-36-7) is a chemical compound with the molecular formula C26H33N5O4 and a molecular weight of 479.6 g/mol. IUPAC name: ethyl 2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carboxylate. InChIKey: VHQNKPIHNBKDDL-UHFFFAOYSA-N.
| Molecular formula | C26H33N5O4 |
|---|---|
| Molecular weight | 479.6 g/mol |
| IUPAC name | ethyl 2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carboxylate |
| InChIKey | VHQNKPIHNBKDDL-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)NC(=N)C1=CC=C(C=C1)NCC2=NC3=C(N2C)C=CC(=C3)C(=O)OCC |
Computed by PubChem (NCBI)