CAS 1408251-82-0 is the registry number for 2,4-dibromophenyl-beta-D-Glucopyranoside. Offered by: TRC. Available pack sizes: 100mg.
(2R,3S,4R,5R,6S)-2-(2,4-dibromophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 1408251-82-0) is a chemical compound with the molecular formula C12H14Br2O6 and a molecular weight of 414.04 g/mol. IUPAC name: (2R,3S,4R,5R,6S)-2-(2,4-dibromophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: MZLXKQXJXRLSRN-SVNGYHJRSA-N.
| Molecular formula | C12H14Br2O6 |
|---|---|
| Molecular weight | 414.04 g/mol |
| IUPAC name | (2R,3S,4R,5R,6S)-2-(2,4-dibromophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | MZLXKQXJXRLSRN-SVNGYHJRSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)