CAS 1408251-84-2 is the registry number for 2,4,6-Tribromophenyl Sulfate Potassium Salt. Offered by: TRC. Available pack sizes: 100mg.
Potassium (2,4,6-tribromophenyl) sulfate (CAS 1408251-84-2) is a chemical compound with the molecular formula C6H2Br3KO4S and a molecular weight of 448.95 g/mol. IUPAC name: potassium (2,4,6-tribromophenyl) sulfate. InChIKey: KVGODSVVPWCAKD-UHFFFAOYSA-M.
| Molecular formula | C6H2Br3KO4S |
|---|---|
| Molecular weight | 448.95 g/mol |
| IUPAC name | potassium (2,4,6-tribromophenyl) sulfate |
| InChIKey | KVGODSVVPWCAKD-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1Br)OS(=O)(=O)[O-])Br)Br.[K+] |
Computed by PubChem (NCBI)