CAS 1408279-24-2 is the registry number for 1-(5-Chloro-2-(methoxymethoxy)phenyl)-2,2,2-trifluoroethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[5-chloro-2-(methoxymethoxy)phenyl]-2,2,2-trifluoroethanone (CAS 1408279-24-2) is a chemical compound with the molecular formula C10H8ClF3O3 and a molecular weight of 268.61 g/mol. IUPAC name: 1-[5-chloro-2-(methoxymethoxy)phenyl]-2,2,2-trifluoroethanone. InChIKey: MOWXSUDMCDBKPG-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O3 |
|---|---|
| Molecular weight | 268.61 g/mol |
| IUPAC name | 1-[5-chloro-2-(methoxymethoxy)phenyl]-2,2,2-trifluoroethanone |
| InChIKey | MOWXSUDMCDBKPG-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C=C(C=C1)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)