CAS 140834-64-6 is the registry number for 5,5,6,6,7,7,8,8,8-Nonafluoro-2-octanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5,5,6,6,7,7,8,8,8-nonafluorooctan-2-one (CAS 140834-64-6) is a chemical compound with the molecular formula C8H7F9O and a molecular weight of 290.13 g/mol. IUPAC name: 5,5,6,6,7,7,8,8,8-nonafluorooctan-2-one. InChIKey: QSFHSDZDCSCCGQ-UHFFFAOYSA-N.
| Molecular formula | C8H7F9O |
|---|---|
| Molecular weight | 290.13 g/mol |
| IUPAC name | 5,5,6,6,7,7,8,8,8-nonafluorooctan-2-one |
| InChIKey | QSFHSDZDCSCCGQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)