Products 14089-43-1
CAS 14089-43-1 is the registry number for Asulam (potassium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Potassium methyl N-(4-aminophenyl)sulfonylcarbamate (CAS 14089-43-1) is a chemical compound with the molecular formula C8H10KN2O4S+ and a molecular weight of 269.34 g/mol. IUPAC name: potassium methyl N-(4-aminophenyl)sulfonylcarbamate. InChIKey: WKJOGZIRDGAEFO-UHFFFAOYSA-N.
| Molecular formula | C8H10KN2O4S+ |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | potassium methyl N-(4-aminophenyl)sulfonylcarbamate |
| InChIKey | WKJOGZIRDGAEFO-UHFFFAOYSA-N |
| SMILES | COC(=O)NS(=O)(=O)C1=CC=C(C=C1)N.[K+] |
Computed by PubChem (NCBI)