CAS 1408992-02-8 is the registry number for Ethyl 2-(2-chloro-4-fluorobenzoyl)butanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 2-(2-chloro-4-fluorobenzoyl)butanoate (CAS 1408992-02-8) is a chemical compound with the molecular formula C13H14ClFO3 and a molecular weight of 272.70 g/mol. IUPAC name: ethyl 2-(2-chloro-4-fluorobenzoyl)butanoate. InChIKey: ZPGSDTSYZMJXAG-UHFFFAOYSA-N.
| Molecular formula | C13H14ClFO3 |
|---|---|
| Molecular weight | 272.70 g/mol |
| IUPAC name | ethyl 2-(2-chloro-4-fluorobenzoyl)butanoate |
| InChIKey | ZPGSDTSYZMJXAG-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=C(C=C(C=C1)F)Cl)C(=O)OCC |
Computed by PubChem (NCBI)