Products 1408992-02-8

CAS 1408992-02-8 is the registry number for Ethyl 2-(2-chloro-4-fluorobenzoyl)butanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-chloro-4-fluorobenzoyl)butanoate (CAS 1408992-02-8) is a chemical compound with the molecular formula C13H14ClFO3 and a molecular weight of 272.70 g/mol. IUPAC name: ethyl 2-(2-chloro-4-fluorobenzoyl)butanoate. InChIKey: ZPGSDTSYZMJXAG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14ClFO3
Molecular weight272.70 g/mol
IUPAC nameethyl 2-(2-chloro-4-fluorobenzoyl)butanoate
InChIKeyZPGSDTSYZMJXAG-UHFFFAOYSA-N
SMILESCCC(C(=O)C1=C(C=C(C=C1)F)Cl)C(=O)OCC

Computed by PubChem (NCBI)