CAS 1409023-06-8 appears in our catalog under these names: 3-(5-(Methanesulfonylmethyl)-1,3,4-oxadiazol-2-yl)benzoic acid, 95%, 3-(5-(Methanesulfonylmethyl)-1,3,4-oxadiazol-2-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[5-(methylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid (CAS 1409023-06-8) is a chemical compound with the molecular formula C11H10N2O5S and a molecular weight of 282.27 g/mol. IUPAC name: 3-[5-(methylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid. InChIKey: SZVBQCXQIISJBO-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O5S |
|---|---|
| Molecular weight | 282.27 g/mol |
| IUPAC name | 3-[5-(methylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
| InChIKey | SZVBQCXQIISJBO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=NN=C(O1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)