CAS 141-18-4 appears in our catalog under these names: Bis(2-butoxyethyl) adipate, 97%, Adipic acid, bis(2-butoxyethyl) ester, Bis(2–butoxyethyl) Adipate, Bis(2-butoxyethyl) Adipate, >97.0%(GC), Bis(2-butoxyethyl) Adipate, 97%(GC-MS),RG, 97%(GC-MS),RG. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, TCI, Chemat. Available pack sizes: 5g, 500g, 25g, 100g, 1g, 500mg, 1X25MG, 1x250mg.
Bis(2-butoxyethyl) hexanedioate (CAS 141-18-4) is a chemical compound with the molecular formula C18H34O6 and a molecular weight of 346.5 g/mol. IUPAC name: bis(2-butoxyethyl) hexanedioate. InChIKey: IHTSDBYPAZEUOP-UHFFFAOYSA-N.
| Molecular formula | C18H34O6 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | bis(2-butoxyethyl) hexanedioate |
| InChIKey | IHTSDBYPAZEUOP-UHFFFAOYSA-N |
| SMILES | CCCCOCCOC(=O)CCCCC(=O)OCCOCCCC |
Computed by PubChem (NCBI)