CAS 141-62-8 appears in our catalog under these names: Decamethyltetrasiloxane, Decamethyltetrasiloxane, >97.0%(GC), Decamethyltetrasiloxane 98% GC, DECAMETHYLTETRASILOXANE, 97%, Decamethyltetrasiloxane, 95%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, TCI, Ambeed. Available pack sizes: 10ml, 1ml, 100g, 500g, 25ml, 5g, 25g, 250g.
[dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane (CAS 141-62-8) is a chemical compound with the molecular formula C10H30O3Si4 and a molecular weight of 310.68 g/mol. IUPAC name: [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane. InChIKey: YFCGDEUVHLPRCZ-UHFFFAOYSA-N.
| Molecular formula | C10H30O3Si4 |
|---|---|
| Molecular weight | 310.68 g/mol |
| IUPAC name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| InChIKey | YFCGDEUVHLPRCZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
Computed by PubChem (NCBI)