Products 141034-43-7
CAS 141034-43-7 is the registry number for JO-1870 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(4-chlorophenyl)-N,N-dimethyl-6-phenylhex-5-en-3-amine;hydrochloride (CAS 141034-43-7) is a chemical compound with the molecular formula C20H25Cl2N and a molecular weight of 350.3 g/mol. IUPAC name: (E)-3-(4-chlorophenyl)-N,N-dimethyl-6-phenylhex-5-en-3-amine;hydrochloride. InChIKey: MGMLEOAQYQETSX-YGCVIUNWSA-N.
| Molecular formula | C20H25Cl2N |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | (E)-3-(4-chlorophenyl)-N,N-dimethyl-6-phenylhex-5-en-3-amine;hydrochloride |
| InChIKey | MGMLEOAQYQETSX-YGCVIUNWSA-N |
| SMILES | CCC(C/C=C/C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)N(C)C.Cl |
Computed by PubChem (NCBI)