CAS 1410737-35-7 appears in our catalog under these names: MI–1061 TFA, MI-1061 (TFA), 97.47%, 97.47%, MI-1061 (TFA), 97.47%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25 mg, 5 mg, 10mM/1mL, 100 mg, 10 mg.
CAS 1410737-35-7 identifies a chemical compound with the molecular formula C32H27Cl2F4N3O6 and a molecular weight of 696.5 g/mol. InChIKey: YVEFTHDIYIEZGS-FLLZXHAKSA-N.
| Molecular formula | C32H27Cl2F4N3O6 |
|---|---|
| Molecular weight | 696.5 g/mol |
| InChIKey | YVEFTHDIYIEZGS-FLLZXHAKSA-N |
| SMILES | C1CCC2(CC1)[C@@]3([C@H]([C@@H](N2)C(=O)NC4=CC=C(C=C4)C(=O)O)C5=C(C(=CC=C5)Cl)F)C6=C(C=C(C=C6)Cl)NC3=O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)