CAS 1410809-15-2 is the registry number for tert-Butyl 4-(4-Acetyl-2-methoxy-5-nitrophenoxy)butanoate, >98.0%(HPLC)(qNMR). Offered by: TCI. Available pack sizes: 1g.
Tert-butyl 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoate (CAS 1410809-15-2) is a chemical compound with the molecular formula C17H23NO7 and a molecular weight of 353.4 g/mol. IUPAC name: tert-butyl 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoate. InChIKey: FOKUGVVSWOZOGS-UHFFFAOYSA-N.
| Molecular formula | C17H23NO7 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | tert-butyl 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoate |
| InChIKey | FOKUGVVSWOZOGS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)