CAS 1410890-97-9 appears in our catalog under these names: 4-(3-Chloro-4-fluorophenoxy)-3-fluorobenzonitrile, 95%, 4-(3-Chloro-4-fluorophenoxy)-3-fluorobenzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(3-chloro-4-fluorophenoxy)-3-fluorobenzonitrile (CAS 1410890-97-9) is a chemical compound with the molecular formula C13H6ClF2NO and a molecular weight of 265.64 g/mol. IUPAC name: 4-(3-chloro-4-fluorophenoxy)-3-fluorobenzonitrile. InChIKey: OHPWZZGPCCYNLY-UHFFFAOYSA-N.
| Molecular formula | C13H6ClF2NO |
|---|---|
| Molecular weight | 265.64 g/mol |
| IUPAC name | 4-(3-chloro-4-fluorophenoxy)-3-fluorobenzonitrile |
| InChIKey | OHPWZZGPCCYNLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)F)OC2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)