CAS 141104-05-4 appears in our catalog under these names: N-(1-Adamantan-1-yl-ethyl)-2-chloro-acetamide, 95%, N-(1-(Adamantan-1-yl)ethyl)-2-chloroacetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 25g, 1g, 100mg.
N-[1-(1-adamantyl)ethyl]-2-chloroacetamide (CAS 141104-05-4) is a chemical compound with the molecular formula C14H22ClNO and a molecular weight of 255.78 g/mol. IUPAC name: N-[1-(1-adamantyl)ethyl]-2-chloroacetamide. InChIKey: WKYMLOXQWMPBKY-UHFFFAOYSA-N.
| Molecular formula | C14H22ClNO |
|---|---|
| Molecular weight | 255.78 g/mol |
| IUPAC name | N-[1-(1-adamantyl)ethyl]-2-chloroacetamide |
| InChIKey | WKYMLOXQWMPBKY-UHFFFAOYSA-N |
| SMILES | CC(C12CC3CC(C1)CC(C3)C2)NC(=O)CCl |
Computed by PubChem (NCBI)