CAS 141109-18-4 appears in our catalog under these names: rac-Clopidogrel EP Impurity F HCl, Methyl 2-(2-chlorophenyl)-2-((2-(thiophen-2-yl)ethyl)amino)acetate hydrochloride 95%, Methyl 2-(2-chlorophenyl)-2-((2-(thiophen-2-yl)ethyl)amino)acetate hydrochloride, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
Methyl 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetate;hydrochloride (CAS 141109-18-4) is a chemical compound with the molecular formula C15H17Cl2NO2S and a molecular weight of 346.3 g/mol. IUPAC name: methyl 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetate;hydrochloride. InChIKey: ZXANKCFSGFEBQW-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO2S |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | methyl 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetate;hydrochloride |
| InChIKey | ZXANKCFSGFEBQW-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=C1Cl)NCCC2=CC=CS2.Cl |
Computed by PubChem (NCBI)