CAS 141183-94-0 is the registry number for 4-(Perfluorooctyl)-2-methyl-2-butanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-ol (CAS 141183-94-0) is a chemical compound with the molecular formula C13H11F17O and a molecular weight of 506.20 g/mol. IUPAC name: 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-ol. InChIKey: VDLOMMAXELCHDN-UHFFFAOYSA-N.
| Molecular formula | C13H11F17O |
|---|---|
| Molecular weight | 506.20 g/mol |
| IUPAC name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-ol |
| InChIKey | VDLOMMAXELCHDN-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)