CAS 14121-49-4 appears in our catalog under these names: Benzothioxanthene dicarboxylic anhydride, 97%, Thioxantheno(2,1,9-def)isochromene-1,3-dione, 97%, Benzothioxanthene dicarboxylic anhydride, 85%, 85%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g, 100g.
14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione (CAS 14121-49-4) is a chemical compound with the molecular formula C18H8O3S and a molecular weight of 304.3 g/mol. IUPAC name: 14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione. InChIKey: YCJAUMBAFBAMFV-UHFFFAOYSA-N.
| Molecular formula | C18H8O3S |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
| InChIKey | YCJAUMBAFBAMFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C(=CC=C5C4=C(C=C3)C(=O)OC5=O)S2 |
Computed by PubChem (NCBI)